C13H7BrF2OS — CID 8853750
(E)-3-(5-bromothiophen-2-yl)-1-(2,6-difluorophenyl)prop-2-en-1-one (PubChem CID 8853750) has the molecular formula C13H7BrF2OS and a molecular weight of 329.17 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-1-(2,6-difluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-1-(2,6-difluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8853750 |
| Molecular Formula | C13H7BrF2OS |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 327.94 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-1-(2,6-difluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Br)s1)c1c(F)cccc1F |
| InChI | InChI=1S/C13H7BrF2OS/c14-12-7-5-8(18-12)4-6-11(17)13-9(15)2-1-3-10(13)16/h1-7H/b6-4+ |
| InChIKey | XWPQEKGJCDRZPS-GQCTYLIASA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|