C14H11BrCl2N2O — CID 19564748
(E)-3-(4-bromo-1-ethylpyrazol-5-yl)-1-(2,4-dichlorophenyl)prop-2-en-1-one (PubChem CID 19564748) has the molecular formula C14H11BrCl2N2O and a molecular weight of 374.07 g/mol. Its IUPAC name is (E)-3-(4-bromo-1-ethylpyrazol-5-yl)-1-(2,4-dichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-bromo-1-ethylpyrazol-5-yl)-1-(2,4-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19564748 |
| Molecular Formula | C14H11BrCl2N2O |
| Molecular Weight | 374.07 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | (E)-3-(4-bromo-1-ethylpyrazol-5-yl)-1-(2,4-dichlorophenyl)prop-2-en-1-one |
| SMILES | CCn1ncc(Br)c1/C=C/C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11BrCl2N2O/c1-2-19-13(11(15)8-18-19)5-6-14(20)10-4-3-9(16)7-12(10)17/h3-8H,2H2,1H3/b6-5+ |
| InChIKey | NFFAZWSRSUNFSK-AATRIKPKSA-N |
| XLogP | 4.87 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.07 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|