C23H21N3O — CID 167940306
(E)-3-(1-benzylpyrazol-4-yl)-1-(1,5-dimethylindol-3-yl)prop-2-en-1-one (PubChem CID 167940306) has the molecular formula C23H21N3O and a molecular weight of 355.44 g/mol. Its IUPAC name is (E)-3-(1-benzylpyrazol-4-yl)-1-(1,5-dimethylindol-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1-benzylpyrazol-4-yl)-1-(1,5-dimethylindol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 167940306 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (E)-3-(1-benzylpyrazol-4-yl)-1-(1,5-dimethylindol-3-yl)prop-2-en-1-one |
| SMILES | Cc1ccc2c(c1)c(C(=O)/C=C/c1cnn(Cc3ccccc3)c1)cn2C |
| InChI | InChI=1S/C23H21N3O/c1-17-8-10-22-20(12-17)21(16-25(22)2)23(27)11-9-19-13-24-26(15-19)14-18-6-4-3-5-7-18/h3-13,15-16H,14H2,1-2H3/b11-9+ |
| InChIKey | UOKQRSCCFMHULR-PKNBQFBNSA-N |
| XLogP | 4.63 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|