C19H16N2O4 — CID 75365038
3-[(E)-3-(1-benzylpyrazol-4-yl)prop-2-enoyl]-6-methylpyran-2,4-dione (PubChem CID 75365038) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 3-[(E)-3-(1-benzylpyrazol-4-yl)prop-2-enoyl]-6-methylpyran-2,4-dione.
| Compound Name | 3-[(E)-3-(1-benzylpyrazol-4-yl)prop-2-enoyl]-6-methylpyran-2,4-dione |
|---|---|
| PubChem CID | 75365038 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-[(E)-3-(1-benzylpyrazol-4-yl)prop-2-enoyl]-6-methylpyran-2,4-dione |
| SMILES | CC1=CC(=O)C(C(=O)/C=C/c2cnn(Cc3ccccc3)c2)C(=O)O1 |
| InChI | InChI=1S/C19H16N2O4/c1-13-9-17(23)18(19(24)25-13)16(22)8-7-15-10-20-21(12-15)11-14-5-3-2-4-6-14/h2-10,12,18H,11H2,1H3/b8-7+ |
| InChIKey | UGYBOUFCZMJYNG-BQYQJAHWSA-N |
| XLogP | 2.16 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|