C17H14O4 — CID 98750620
(3S)-6-methyl-3-[(2E,4Z)-5-phenylpenta-2,4-dienoyl]pyran-2,4-dione (PubChem CID 98750620) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is (3S)-6-methyl-3-[(2E,4Z)-5-phenylpenta-2,4-dienoyl]pyran-2,4-dione.
| Compound Name | (3S)-6-methyl-3-[(2E,4Z)-5-phenylpenta-2,4-dienoyl]pyran-2,4-dione |
|---|---|
| PubChem CID | 98750620 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (3S)-6-methyl-3-[(2E,4Z)-5-phenylpenta-2,4-dienoyl]pyran-2,4-dione |
| SMILES | CC1=CC(=O)[C@H](C(=O)/C=C/C=C\c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C17H14O4/c1-12-11-15(19)16(17(20)21-12)14(18)10-6-5-9-13-7-3-2-4-8-13/h2-11,16H,1H3/b9-5-,10-6+/t16-/m0/s1 |
| InChIKey | FUXBCZLBEXXKEN-OEHVOWKFSA-N |
| XLogP | 2.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|