C17H12O4S2 — CID 98317933
(3S)-6-methyl-3-[(E)-3-(4-thiophen-2-ylthiophen-2-yl)prop-2-enoyl]pyran-2,4-dione (PubChem CID 98317933) has the molecular formula C17H12O4S2 and a molecular weight of 344.41 g/mol. Its IUPAC name is (3S)-6-methyl-3-[(E)-3-(4-thiophen-2-ylthiophen-2-yl)prop-2-enoyl]pyran-2,4-dione.
| Compound Name | (3S)-6-methyl-3-[(E)-3-(4-thiophen-2-ylthiophen-2-yl)prop-2-enoyl]pyran-2,4-dione |
|---|---|
| PubChem CID | 98317933 |
| Molecular Formula | C17H12O4S2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | (3S)-6-methyl-3-[(E)-3-(4-thiophen-2-ylthiophen-2-yl)prop-2-enoyl]pyran-2,4-dione |
| SMILES | CC1=CC(=O)[C@H](C(=O)/C=C/c2cc(-c3cccs3)cs2)C(=O)O1 |
| InChI | InChI=1S/C17H12O4S2/c1-10-7-14(19)16(17(20)21-10)13(18)5-4-12-8-11(9-23-12)15-3-2-6-22-15/h2-9,16H,1H3/b5-4+/t16-/m0/s1 |
| InChIKey | WGPZIAJQDAAMSK-APHBUQMISA-N |
| XLogP | 3.70 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|