C14H19NOS2 — CID 107302865
5-[(4-thiophen-2-ylthiophen-2-yl)methylamino]pentan-1-ol (PubChem CID 107302865) has the molecular formula C14H19NOS2 and a molecular weight of 281.45 g/mol. Its IUPAC name is 5-[(4-thiophen-2-ylthiophen-2-yl)methylamino]pentan-1-ol.
| Compound Name | 5-[(4-thiophen-2-ylthiophen-2-yl)methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 107302865 |
| Molecular Formula | C14H19NOS2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 5-[(4-thiophen-2-ylthiophen-2-yl)methylamino]pentan-1-ol |
| SMILES | OCCCCCNCc1cc(-c2cccs2)cs1 |
| InChI | InChI=1S/C14H19NOS2/c16-7-3-1-2-6-15-10-13-9-12(11-18-13)14-5-4-8-17-14/h4-5,8-9,11,15-16H,1-3,6-7,10H2 |
| InChIKey | ZYRLNMOTNINNJL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|