C16H22N2S2 — CID 43433717
3-pyrrolidin-1-yl-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]propan-1-amine (PubChem CID 43433717) has the molecular formula C16H22N2S2 and a molecular weight of 306.50 g/mol. Its IUPAC name is 3-pyrrolidin-1-yl-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]propan-1-amine.
| Compound Name | 3-pyrrolidin-1-yl-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 43433717 |
| Molecular Formula | C16H22N2S2 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3-pyrrolidin-1-yl-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]propan-1-amine |
| SMILES | c1csc(-c2csc(CNCCCN3CCCC3)c2)c1 |
| InChI | InChI=1S/C16H22N2S2/c1-2-8-18(7-1)9-4-6-17-12-15-11-14(13-20-15)16-5-3-10-19-16/h3,5,10-11,13,17H,1-2,4,6-9,12H2 |
| InChIKey | WATTUXZKCDFESO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|