C15H21NOS2 — CID 103924165
6-[(4-thiophen-2-ylthiophen-2-yl)methylamino]hexan-1-ol (PubChem CID 103924165) has the molecular formula C15H21NOS2 and a molecular weight of 295.47 g/mol. Its IUPAC name is 6-[(4-thiophen-2-ylthiophen-2-yl)methylamino]hexan-1-ol.
| Compound Name | 6-[(4-thiophen-2-ylthiophen-2-yl)methylamino]hexan-1-ol |
|---|---|
| PubChem CID | 103924165 |
| Molecular Formula | C15H21NOS2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 6-[(4-thiophen-2-ylthiophen-2-yl)methylamino]hexan-1-ol |
| SMILES | OCCCCCCNCc1cc(-c2cccs2)cs1 |
| InChI | InChI=1S/C15H21NOS2/c17-8-4-2-1-3-7-16-11-14-10-13(12-19-14)15-6-5-9-18-15/h5-6,9-10,12,16-17H,1-4,7-8,11H2 |
| InChIKey | QVOIZLNRQVSWJC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|