C16H23NOS2 — CID 103707851
3-[[(4-thiophen-2-ylthiophen-2-yl)methylamino]methyl]hexan-1-ol (PubChem CID 103707851) has the molecular formula C16H23NOS2 and a molecular weight of 309.50 g/mol. Its IUPAC name is 3-[[(4-thiophen-2-ylthiophen-2-yl)methylamino]methyl]hexan-1-ol.
| Compound Name | 3-[[(4-thiophen-2-ylthiophen-2-yl)methylamino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 103707851 |
| Molecular Formula | C16H23NOS2 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-[[(4-thiophen-2-ylthiophen-2-yl)methylamino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNCc1cc(-c2cccs2)cs1 |
| InChI | InChI=1S/C16H23NOS2/c1-2-4-13(6-7-18)10-17-11-15-9-14(12-20-15)16-5-3-8-19-16/h3,5,8-9,12-13,17-18H,2,4,6-7,10-11H2,1H3 |
| InChIKey | TYIKZVKCXCUTHJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |