C13H17NOS3 — CID 115763952
2-methylsulfinyl-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]propan-1-amine (PubChem CID 115763952) has the molecular formula C13H17NOS3 and a molecular weight of 299.49 g/mol. Its IUPAC name is 2-methylsulfinyl-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]propan-1-amine.
| Compound Name | 2-methylsulfinyl-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115763952 |
| Molecular Formula | C13H17NOS3 |
| Molecular Weight | 299.49 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-methylsulfinyl-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]propan-1-amine |
| SMILES | CC(CNCc1cc(-c2cccs2)cs1)S(C)=O |
| InChI | InChI=1S/C13H17NOS3/c1-10(18(2)15)7-14-8-12-6-11(9-17-12)13-4-3-5-16-13/h3-6,9-10,14H,7-8H2,1-2H3 |
| InChIKey | CHNQLHPTAKVPCQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |