C15H21NO2S2 — CID 112727524
2,2-diethoxy-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine (PubChem CID 112727524) has the molecular formula C15H21NO2S2 and a molecular weight of 311.47 g/mol. Its IUPAC name is 2,2-diethoxy-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine.
| Compound Name | 2,2-diethoxy-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 112727524 |
| Molecular Formula | C15H21NO2S2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2,2-diethoxy-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]ethanamine |
| SMILES | CCOC(CNCc1cc(-c2cccs2)cs1)OCC |
| InChI | InChI=1S/C15H21NO2S2/c1-3-17-15(18-4-2)10-16-9-13-8-12(11-20-13)14-6-5-7-19-14/h5-8,11,15-16H,3-4,9-10H2,1-2H3 |
| InChIKey | FVLCTQCMZSMOFQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|