C16H23NOS2 — CID 106252309
2-ethyl-2-[[(4-thiophen-2-ylthiophen-2-yl)methylamino]methyl]butan-1-ol (PubChem CID 106252309) has the molecular formula C16H23NOS2 and a molecular weight of 309.50 g/mol. Its IUPAC name is 2-ethyl-2-[[(4-thiophen-2-ylthiophen-2-yl)methylamino]methyl]butan-1-ol.
| Compound Name | 2-ethyl-2-[[(4-thiophen-2-ylthiophen-2-yl)methylamino]methyl]butan-1-ol |
|---|---|
| PubChem CID | 106252309 |
| Molecular Formula | C16H23NOS2 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-ethyl-2-[[(4-thiophen-2-ylthiophen-2-yl)methylamino]methyl]butan-1-ol |
| SMILES | CCC(CC)(CO)CNCc1cc(-c2cccs2)cs1 |
| InChI | InChI=1S/C16H23NOS2/c1-3-16(4-2,12-18)11-17-9-14-8-13(10-20-14)15-6-5-7-19-15/h5-8,10,17-18H,3-4,9,11-12H2,1-2H3 |
| InChIKey | SHKFIAFUOFGLDX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |