C24H18N2O4 — CID 98392811
(3S)-3-[(Z)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]-6-methylpyran-2,4-dione (PubChem CID 98392811) has the molecular formula C24H18N2O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is (3S)-3-[(Z)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]-6-methylpyran-2,4-dione.
| Compound Name | (3S)-3-[(Z)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]-6-methylpyran-2,4-dione |
|---|---|
| PubChem CID | 98392811 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (3S)-3-[(Z)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]-6-methylpyran-2,4-dione |
| SMILES | CC1=CC(=O)[C@H](C(=O)/C=C\c2cn(-c3ccccc3)nc2-c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C24H18N2O4/c1-16-14-21(28)22(24(29)30-16)20(27)13-12-18-15-26(19-10-6-3-7-11-19)25-23(18)17-8-4-2-5-9-17/h2-15,22H,1H3/b13-12-/t22-/m0/s1 |
| InChIKey | QFNSZRXIILIRGB-MLUDITRGSA-N |
| XLogP | 3.77 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|