C18H22N2OS2 — CID 56808711
cyclopropyl-[4-[(4-thiophen-2-ylthiophen-2-yl)methylamino]piperidin-1-yl]methanone (PubChem CID 56808711) has the molecular formula C18H22N2OS2 and a molecular weight of 346.52 g/mol. Its IUPAC name is cyclopropyl-[4-[(4-thiophen-2-ylthiophen-2-yl)methylamino]piperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-[(4-thiophen-2-ylthiophen-2-yl)methylamino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 56808711 |
| Molecular Formula | C18H22N2OS2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | cyclopropyl-[4-[(4-thiophen-2-ylthiophen-2-yl)methylamino]piperidin-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CCC(NCc2cc(-c3cccs3)cs2)CC1 |
| InChI | InChI=1S/C18H22N2OS2/c21-18(13-3-4-13)20-7-5-15(6-8-20)19-11-16-10-14(12-23-16)17-2-1-9-22-17/h1-2,9-10,12-13,15,19H,3-8,11H2 |
| InChIKey | YRUMMHCSJDOVPB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |