C30H28O4 — CID 173138754
1-(oxiran-2-yl)-7-phenylhepta-2,4,6-trien-1-one (PubChem CID 173138754) has the molecular formula C30H28O4 and a molecular weight of 452.55 g/mol. Its IUPAC name is 1-(oxiran-2-yl)-7-phenylhepta-2,4,6-trien-1-one.
| Compound Name | 1-(oxiran-2-yl)-7-phenylhepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 173138754 |
| Molecular Formula | C30H28O4 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 1-(oxiran-2-yl)-7-phenylhepta-2,4,6-trien-1-one |
| SMILES | O=C(C=CC=CC=Cc1ccccc1)C1CO1.O=C(C=CC=CC=Cc1ccccc1)C1CO1 |
| InChI | InChI=1S/2C15H14O2/c2*16-14(15-12-17-15)11-7-2-1-4-8-13-9-5-3-6-10-13/h2*1-11,15H,12H2 |
| InChIKey | MMLAUKMUMXBKPF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|