C20H20ClN3 — CID 4172043
N-[(4-tert-butylphenyl)methylideneamino]-7-chloroquinolin-4-amine (PubChem CID 4172043) has the molecular formula C20H20ClN3 and a molecular weight of 337.85 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methylideneamino]-7-chloroquinolin-4-amine.
| Compound Name | N-[(4-tert-butylphenyl)methylideneamino]-7-chloroquinolin-4-amine |
|---|---|
| PubChem CID | 4172043 |
| Molecular Formula | C20H20ClN3 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-[(4-tert-butylphenyl)methylideneamino]-7-chloroquinolin-4-amine |
| SMILES | CC(C)(C)c1ccc(C=NNc2ccnc3cc(Cl)ccc23)cc1 |
| InChI | InChI=1S/C20H20ClN3/c1-20(2,3)15-6-4-14(5-7-15)13-23-24-18-10-11-22-19-12-16(21)8-9-17(18)19/h4-13H,1-3H3,(H,22,24) |
| InChIKey | RCTXPHAFMQRCMD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|