C17H12ClF2N3O — CID 6056999
7-chloro-N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]quinolin-4-amine (PubChem CID 6056999) has the molecular formula C17H12ClF2N3O and a molecular weight of 347.75 g/mol. Its IUPAC name is 7-chloro-N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]quinolin-4-amine.
| Compound Name | 7-chloro-N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]quinolin-4-amine |
|---|---|
| PubChem CID | 6056999 |
| Molecular Formula | C17H12ClF2N3O |
| Molecular Weight | 347.75 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 7-chloro-N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]quinolin-4-amine |
| SMILES | FC(F)Oc1ccc(/C=N\Nc2ccnc3cc(Cl)ccc23)cc1 |
| InChI | InChI=1S/C17H12ClF2N3O/c18-12-3-6-14-15(7-8-21-16(14)9-12)23-22-10-11-1-4-13(5-2-11)24-17(19)20/h1-10,17H,(H,21,23)/b22-10- |
| InChIKey | JNGNVISRIGMQPO-YVNNLAQVSA-N |
| XLogP | 4.94 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.75 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|