C11H7ClF3NO3S2 — CID 3813327
5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]thiophene-2-sulfonic acid (PubChem CID 3813327) has the molecular formula C11H7ClF3NO3S2 and a molecular weight of 357.76 g/mol. Its IUPAC name is 5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]thiophene-2-sulfonic acid.
| Compound Name | 5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]thiophene-2-sulfonic acid |
|---|---|
| PubChem CID | 3813327 |
| Molecular Formula | C11H7ClF3NO3S2 |
| Molecular Weight | 357.76 g/mol |
| Exact Mass | 356.95 |
| IUPAC Name | 5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]thiophene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(Cc2ncc(C(F)(F)F)cc2Cl)s1 |
| InChI | InChI=1S/C11H7ClF3NO3S2/c12-8-3-6(11(13,14)15)5-16-9(8)4-7-1-2-10(20-7)21(17,18)19/h1-3,5H,4H2,(H,17,18,19) |
| InChIKey | VPGBPEJMPSLGOO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.76 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|