C18H12ClF3N2O2S2 — CID 1484318
1-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]thiophen-2-yl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylethanone (PubChem CID 1484318) has the molecular formula C18H12ClF3N2O2S2 and a molecular weight of 444.89 g/mol. Its IUPAC name is 1-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]thiophen-2-yl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylethanone.
| Compound Name | 1-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]thiophen-2-yl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylethanone |
|---|---|
| PubChem CID | 1484318 |
| Molecular Formula | C18H12ClF3N2O2S2 |
| Molecular Weight | 444.89 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | 1-[5-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]thiophen-2-yl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylethanone |
| SMILES | O=C(CSc1cccc[n+]1[O-])c1ccc(Cc2ncc(C(F)(F)F)cc2Cl)s1 |
| InChI | InChI=1S/C18H12ClF3N2O2S2/c19-13-7-11(18(20,21)22)9-23-14(13)8-12-4-5-16(28-12)15(25)10-27-17-3-1-2-6-24(17)26/h1-7,9H,8,10H2 |
| InChIKey | OZEDXXPZHCXWPI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 56.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.89 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|