C20H18ClF3N2O5 — CID 142381959
dimethyl 2-(2-benzamidoethyl)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanedioate (PubChem CID 142381959) has the molecular formula C20H18ClF3N2O5 and a molecular weight of 458.82 g/mol. Its IUPAC name is dimethyl 2-(2-benzamidoethyl)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanedioate.
| Compound Name | dimethyl 2-(2-benzamidoethyl)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanedioate |
|---|---|
| PubChem CID | 142381959 |
| Molecular Formula | C20H18ClF3N2O5 |
| Molecular Weight | 458.82 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | dimethyl 2-(2-benzamidoethyl)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanedioate |
| SMILES | COC(=O)C(CCNC(=O)c1ccccc1)(C(=O)OC)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C20H18ClF3N2O5/c1-30-17(28)19(18(29)31-2,8-9-25-16(27)12-6-4-3-5-7-12)15-14(21)10-13(11-26-15)20(22,23)24/h3-7,10-11H,8-9H2,1-2H3,(H,25,27) |
| InChIKey | BIQKBQQLTQALIH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.82 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|