C10H12ClF3N2O — CID 43080874
3-chloro-N-(1-methoxypropan-2-yl)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 43080874) has the molecular formula C10H12ClF3N2O and a molecular weight of 268.67 g/mol. Its IUPAC name is 3-chloro-N-(1-methoxypropan-2-yl)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-(1-methoxypropan-2-yl)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 43080874 |
| Molecular Formula | C10H12ClF3N2O |
| Molecular Weight | 268.67 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 3-chloro-N-(1-methoxypropan-2-yl)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | COCC(C)Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H12ClF3N2O/c1-6(5-17-2)16-9-8(11)3-7(4-15-9)10(12,13)14/h3-4,6H,5H2,1-2H3,(H,15,16) |
| InChIKey | YDJQSFNJTSHDMZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.67 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |