C20H19N3O2 — CID 133477197
4-[[2-hydroxy-2-(4-phenylphenyl)ethyl]amino]pyridine-3-carboxamide (PubChem CID 133477197) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-[[2-hydroxy-2-(4-phenylphenyl)ethyl]amino]pyridine-3-carboxamide.
| Compound Name | 4-[[2-hydroxy-2-(4-phenylphenyl)ethyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133477197 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 4-[[2-hydroxy-2-(4-phenylphenyl)ethyl]amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnccc1NCC(O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19N3O2/c21-20(25)17-12-22-11-10-18(17)23-13-19(24)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-12,19,24H,13H2,(H2,21,25)(H,22,23) |
| InChIKey | CCRUSTFBPMFSHZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |