C17H22N4O — CID 133468935
4-[[2-(dimethylamino)-2-(4-methylphenyl)ethyl]amino]pyridine-3-carboxamide (PubChem CID 133468935) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-[[2-(dimethylamino)-2-(4-methylphenyl)ethyl]amino]pyridine-3-carboxamide.
| Compound Name | 4-[[2-(dimethylamino)-2-(4-methylphenyl)ethyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133468935 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 4-[[2-(dimethylamino)-2-(4-methylphenyl)ethyl]amino]pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(CNc2ccncc2C(N)=O)N(C)C)cc1 |
| InChI | InChI=1S/C17H22N4O/c1-12-4-6-13(7-5-12)16(21(2)3)11-20-15-8-9-19-10-14(15)17(18)22/h4-10,16H,11H2,1-3H3,(H2,18,22)(H,19,20) |
| InChIKey | NINOHZCZLQUOIR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |