C17H24N4O2S — CID 133299226
6-[[2-(dimethylamino)-2-(4-methylphenyl)ethyl]amino]-N-methylpyridine-3-sulfonamide (PubChem CID 133299226) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 6-[[2-(dimethylamino)-2-(4-methylphenyl)ethyl]amino]-N-methylpyridine-3-sulfonamide.
| Compound Name | 6-[[2-(dimethylamino)-2-(4-methylphenyl)ethyl]amino]-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133299226 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 6-[[2-(dimethylamino)-2-(4-methylphenyl)ethyl]amino]-N-methylpyridine-3-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCC(c2ccc(C)cc2)N(C)C)nc1 |
| InChI | InChI=1S/C17H24N4O2S/c1-13-5-7-14(8-6-13)16(21(3)4)12-20-17-10-9-15(11-19-17)24(22,23)18-2/h5-11,16,18H,12H2,1-4H3,(H,19,20) |
| InChIKey | QNRUIGYJFHHMBV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |