C17H18ClF3N2O2S — CID 2468122
4-chloro-N-[(2R)-2-(dimethylamino)-2-phenylethyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 2468122) has the molecular formula C17H18ClF3N2O2S and a molecular weight of 406.86 g/mol. Its IUPAC name is 4-chloro-N-[(2R)-2-(dimethylamino)-2-phenylethyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[(2R)-2-(dimethylamino)-2-phenylethyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2468122 |
| Molecular Formula | C17H18ClF3N2O2S |
| Molecular Weight | 406.86 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 4-chloro-N-[(2R)-2-(dimethylamino)-2-phenylethyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN(C)[C@@H](CNS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C17H18ClF3N2O2S/c1-23(2)16(12-6-4-3-5-7-12)11-22-26(24,25)13-8-9-15(18)14(10-13)17(19,20)21/h3-10,16,22H,11H2,1-2H3/t16-/m0/s1 |
| InChIKey | HCEFMAPEDPHCHW-INIZCTEOSA-N |
| XLogP | 3.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.86 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |