C17H25ClN4O2S — CID 60531244
4-chloro-3-cyano-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]benzenesulfonamide (PubChem CID 60531244) has the molecular formula C17H25ClN4O2S and a molecular weight of 384.93 g/mol. Its IUPAC name is 4-chloro-3-cyano-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]benzenesulfonamide.
| Compound Name | 4-chloro-3-cyano-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 60531244 |
| Molecular Formula | C17H25ClN4O2S |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-chloro-3-cyano-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]benzenesulfonamide |
| SMILES | CC(C)C(CNS(=O)(=O)c1ccc(Cl)c(C#N)c1)N1CCN(C)CC1 |
| InChI | InChI=1S/C17H25ClN4O2S/c1-13(2)17(22-8-6-21(3)7-9-22)12-20-25(23,24)15-4-5-16(18)14(10-15)11-19/h4-5,10,13,17,20H,6-9,12H2,1-3H3 |
| InChIKey | QWAULSLMRIKYPH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |