C10H10F3NO4 — CID 117416529
2-amino-3-[2,5-dihydroxy-3-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 117416529) has the molecular formula C10H10F3NO4 and a molecular weight of 265.19 g/mol. Its IUPAC name is 2-amino-3-[2,5-dihydroxy-3-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[2,5-dihydroxy-3-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 117416529 |
| Molecular Formula | C10H10F3NO4 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 2-amino-3-[2,5-dihydroxy-3-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | NC(Cc1cc(O)cc(C(F)(F)F)c1O)C(=O)O |
| InChI | InChI=1S/C10H10F3NO4/c11-10(12,13)6-3-5(15)1-4(8(6)16)2-7(14)9(17)18/h1,3,7,15-16H,2,14H2,(H,17,18) |
| InChIKey | VVOUKHKUOPNPHF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|