C13H12BrF2NO5 — CID 167729886
3-(5-bromo-2,3-difluoro-4-hydroxyphenyl)-2-(prop-2-enoxycarbonylamino)propanoic acid (PubChem CID 167729886) has the molecular formula C13H12BrF2NO5 and a molecular weight of 380.14 g/mol. Its IUPAC name is 3-(5-bromo-2,3-difluoro-4-hydroxyphenyl)-2-(prop-2-enoxycarbonylamino)propanoic acid.
| Compound Name | 3-(5-bromo-2,3-difluoro-4-hydroxyphenyl)-2-(prop-2-enoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 167729886 |
| Molecular Formula | C13H12BrF2NO5 |
| Molecular Weight | 380.14 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 3-(5-bromo-2,3-difluoro-4-hydroxyphenyl)-2-(prop-2-enoxycarbonylamino)propanoic acid |
| SMILES | C=CCOC(=O)NC(Cc1cc(Br)c(O)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C13H12BrF2NO5/c1-2-3-22-13(21)17-8(12(19)20)5-6-4-7(14)11(18)10(16)9(6)15/h2,4,8,18H,1,3,5H2,(H,17,21)(H,19,20) |
| InChIKey | HSPSANOSJRHOSF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.14 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|