C13H17FN2O2 — CID 145142426
2-amino-3-(4-fluoro-1H-indol-3-yl)propanoic acid;ethane (PubChem CID 145142426) has the molecular formula C13H17FN2O2 and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-amino-3-(4-fluoro-1H-indol-3-yl)propanoic acid;ethane.
| Compound Name | 2-amino-3-(4-fluoro-1H-indol-3-yl)propanoic acid;ethane |
|---|---|
| PubChem CID | 145142426 |
| Molecular Formula | C13H17FN2O2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-amino-3-(4-fluoro-1H-indol-3-yl)propanoic acid;ethane |
| SMILES | CC.NC(Cc1c[nH]c2cccc(F)c12)C(=O)O |
| InChI | InChI=1S/C11H11FN2O2.C2H6/c12-7-2-1-3-9-10(7)6(5-14-9)4-8(13)11(15)16;1-2/h1-3,5,8,14H,4,13H2,(H,15,16);1-2H3 |
| InChIKey | KJNSAQRRCMGBTH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |