C13H12N2O2 — CID 122499648
2-amino-3-(4-ethynyl-1H-indol-3-yl)propanoic acid (PubChem CID 122499648) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-amino-3-(4-ethynyl-1H-indol-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(4-ethynyl-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 122499648 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-amino-3-(4-ethynyl-1H-indol-3-yl)propanoic acid |
| SMILES | C#Cc1cccc2[nH]cc(CC(N)C(=O)O)c12 |
| InChI | InChI=1S/C13H12N2O2/c1-2-8-4-3-5-11-12(8)9(7-15-11)6-10(14)13(16)17/h1,3-5,7,10,15H,6,14H2,(H,16,17) |
| InChIKey | NCCPBIDUCVPASN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|