C11H11FN2O2 — CID 177451224
(2S)-2-amino-3-(4-(18F)fluoro-1H-indol-3-yl)propanoic acid (PubChem CID 177451224) has the molecular formula C11H11FN2O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-(18F)fluoro-1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(4-(18F)fluoro-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 177451224 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | (2S)-2-amino-3-(4-(18F)fluoro-1H-indol-3-yl)propanoic acid |
| SMILES | N[C@@H](Cc1c[nH]c2cccc([18F])c12)C(=O)O |
| InChI | InChI=1S/C11H11FN2O2/c12-7-2-1-3-9-10(7)6(5-14-9)4-8(13)11(15)16/h1-3,5,8,14H,4,13H2,(H,15,16)/t8-/m0/s1/i12-1 |
| InChIKey | DEBQMEYEKKWIKC-JUZQRKEFSA-N |
| XLogP | 1.26 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |