C14H18FN2OP — CID 177194442
1-(4-fluoro-1H-indol-3-yl)-4-methyl-2-(phosphanylamino)pentan-3-one (PubChem CID 177194442) has the molecular formula C14H18FN2OP and a molecular weight of 280.28 g/mol. Its IUPAC name is 1-(4-fluoro-1H-indol-3-yl)-4-methyl-2-(phosphanylamino)pentan-3-one.
| Compound Name | 1-(4-fluoro-1H-indol-3-yl)-4-methyl-2-(phosphanylamino)pentan-3-one |
|---|---|
| PubChem CID | 177194442 |
| Molecular Formula | C14H18FN2OP |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-(4-fluoro-1H-indol-3-yl)-4-methyl-2-(phosphanylamino)pentan-3-one |
| SMILES | CC(C)C(=O)C(Cc1c[nH]c2cccc(F)c12)NP |
| InChI | InChI=1S/C14H18FN2OP/c1-8(2)14(18)12(17-19)6-9-7-16-11-5-3-4-10(15)13(9)11/h3-5,7-8,12,16-17H,6,19H2,1-2H3 |
| InChIKey | PBOVOJATNQWEKR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|