C16H12ClFN2O4 — CID 167862017
2-[(5-chlorofuran-2-carbonyl)amino]-3-(4-fluoro-1H-indol-3-yl)propanoic acid (PubChem CID 167862017) has the molecular formula C16H12ClFN2O4 and a molecular weight of 350.73 g/mol. Its IUPAC name is 2-[(5-chlorofuran-2-carbonyl)amino]-3-(4-fluoro-1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[(5-chlorofuran-2-carbonyl)amino]-3-(4-fluoro-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 167862017 |
| Molecular Formula | C16H12ClFN2O4 |
| Molecular Weight | 350.73 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2-[(5-chlorofuran-2-carbonyl)amino]-3-(4-fluoro-1H-indol-3-yl)propanoic acid |
| SMILES | O=C(NC(Cc1c[nH]c2cccc(F)c12)C(=O)O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C16H12ClFN2O4/c17-13-5-4-12(24-13)15(21)20-11(16(22)23)6-8-7-19-10-3-1-2-9(18)14(8)10/h1-5,7,11,19H,6H2,(H,20,21)(H,22,23) |
| InChIKey | NONQTUYGSZBAQA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.73 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |