C16H13ClN2O4 — CID 124705268
(2R)-2-[(5-chlorofuran-2-carbonyl)amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 124705268) has the molecular formula C16H13ClN2O4 and a molecular weight of 332.74 g/mol. Its IUPAC name is (2R)-2-[(5-chlorofuran-2-carbonyl)amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2R)-2-[(5-chlorofuran-2-carbonyl)amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 124705268 |
| Molecular Formula | C16H13ClN2O4 |
| Molecular Weight | 332.74 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | (2R)-2-[(5-chlorofuran-2-carbonyl)amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(N[C@H](Cc1c[nH]c2ccccc12)C(=O)O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C16H13ClN2O4/c17-14-6-5-13(23-14)15(20)19-12(16(21)22)7-9-8-18-11-4-2-1-3-10(9)11/h1-6,8,12,18H,7H2,(H,19,20)(H,21,22)/t12-/m1/s1 |
| InChIKey | UPZNUYHJXSVQMF-GFCCVEGCSA-N |
| XLogP | 2.84 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.74 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |