C17H15N2O4- — CID 6923792
(2S)-3-(1H-indol-3-yl)-2-[(5-methylfuran-2-carbonyl)amino]propanoate (PubChem CID 6923792) has the molecular formula C17H15N2O4- and a molecular weight of 311.32 g/mol. Its IUPAC name is (2S)-3-(1H-indol-3-yl)-2-[(5-methylfuran-2-carbonyl)amino]propanoate.
| Compound Name | (2S)-3-(1H-indol-3-yl)-2-[(5-methylfuran-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 6923792 |
| Molecular Formula | C17H15N2O4- |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | (2S)-3-(1H-indol-3-yl)-2-[(5-methylfuran-2-carbonyl)amino]propanoate |
| SMILES | Cc1ccc(C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)[O-])o1 |
| InChI | InChI=1S/C17H16N2O4/c1-10-6-7-15(23-10)16(20)19-14(17(21)22)8-11-9-18-13-5-3-2-4-12(11)13/h2-7,9,14,18H,8H2,1H3,(H,19,20)(H,21,22)/p-1/t14-/m0/s1 |
| InChIKey | JKKNHOYMARTPDL-AWEZNQCLSA-M |
| XLogP | 1.16 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |