C16H23ClN2O2 — CID 170885766
ethyl 2-amino-3-(2-chloro-5-methyl-4-pyrrolidin-1-ylphenyl)propanoate (PubChem CID 170885766) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is ethyl 2-amino-3-(2-chloro-5-methyl-4-pyrrolidin-1-ylphenyl)propanoate.
| Compound Name | ethyl 2-amino-3-(2-chloro-5-methyl-4-pyrrolidin-1-ylphenyl)propanoate |
|---|---|
| PubChem CID | 170885766 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | ethyl 2-amino-3-(2-chloro-5-methyl-4-pyrrolidin-1-ylphenyl)propanoate |
| SMILES | CCOC(=O)C(N)Cc1cc(C)c(N2CCCC2)cc1Cl |
| InChI | InChI=1S/C16H23ClN2O2/c1-3-21-16(20)14(18)9-12-8-11(2)15(10-13(12)17)19-6-4-5-7-19/h8,10,14H,3-7,9,18H2,1-2H3 |
| InChIKey | FFBYYTKLSZQFHW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |