C15H15FN2 — CID 115366831
[4-(1,3-dihydroisoindol-2-yl)-2-fluorophenyl]methanamine (PubChem CID 115366831) has the molecular formula C15H15FN2 and a molecular weight of 242.30 g/mol. Its IUPAC name is [4-(1,3-dihydroisoindol-2-yl)-2-fluorophenyl]methanamine.
| Compound Name | [4-(1,3-dihydroisoindol-2-yl)-2-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 115366831 |
| Molecular Formula | C15H15FN2 |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | [4-(1,3-dihydroisoindol-2-yl)-2-fluorophenyl]methanamine |
| SMILES | NCc1ccc(N2Cc3ccccc3C2)cc1F |
| InChI | InChI=1S/C15H15FN2/c16-15-7-14(6-5-11(15)8-17)18-9-12-3-1-2-4-13(12)10-18/h1-7H,8-10,17H2 |
| InChIKey | VVWYCUSTZUXKCU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |