About 4-[4-(bromomethyl)phenyl]-1,4-oxazepane
4-[4-(bromomethyl)phenyl]-1,4-oxazepane (PubChem CID 107082990) has the molecular formula C12H16BrNO
and a molecular weight of 270.17 g/mol. Its IUPAC name is 4-[4-(bromomethyl)phenyl]-1,4-oxazepane.
Molecular Properties
| Compound Name | 4-[4-(bromomethyl)phenyl]-1,4-oxazepane |
| PubChem CID | 107082990 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 4-[4-(bromomethyl)phenyl]-1,4-oxazepane |
| SMILES | BrCc1ccc(N2CCCOCC2)cc1 |
| InChI | InChI=1S/C12H16BrNO/c13-10-11-2-4-12(5-3-11)14-6-1-8-15-9-7-14/h2-5H,1,6-10H2 |
| InChIKey | XGJURMYFUOREBL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(bromomethyl)phenyl]-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(bromomethyl)phenyl]-1,4-oxazepane?
The IUPAC name of 4-[4-(bromomethyl)phenyl]-1,4-oxazepane (CID 107082990) is 4-[4-(bromomethyl)phenyl]-1,4-oxazepane.
What is the SMILES notation for 4-[4-(bromomethyl)phenyl]-1,4-oxazepane?
The canonical SMILES for 4-[4-(bromomethyl)phenyl]-1,4-oxazepane is BrCc1ccc(N2CCCOCC2)cc1.
What is the InChIKey of 4-[4-(bromomethyl)phenyl]-1,4-oxazepane?
The InChIKey is XGJURMYFUOREBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrNO/c13-10-11-2-4-12(5-3-11)14-6-1-8-15-9-7-14/h2-5H,1,6-10H2.
What are the key properties of 4-[4-(bromomethyl)phenyl]-1,4-oxazepane?
4-[4-(bromomethyl)phenyl]-1,4-oxazepane has a molecular weight of 270.17 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(bromomethyl)phenyl]-1,4-oxazepane is sourced from PubChem (CID 107082990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).