About 4-(1,5,3-dithiazocan-3-yl)phenol
4-(1,5,3-dithiazocan-3-yl)phenol (PubChem CID 146020778) has the molecular formula C11H15NOS2
and a molecular weight of 241.38 g/mol. Its IUPAC name is 4-(1,5,3-dithiazocan-3-yl)phenol.
Molecular Properties
| Compound Name | 4-(1,5,3-dithiazocan-3-yl)phenol |
| PubChem CID | 146020778 |
| Molecular Formula | C11H15NOS2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 4-(1,5,3-dithiazocan-3-yl)phenol |
| SMILES | Oc1ccc(N2CSCCCSC2)cc1 |
| InChI | InChI=1S/C11H15NOS2/c13-11-4-2-10(3-5-11)12-8-14-6-1-7-15-9-12/h2-5,13H,1,6-9H2 |
| InChIKey | LZDCKUIUIIYURR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,5,3-dithiazocan-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,5,3-dithiazocan-3-yl)phenol?
The IUPAC name of 4-(1,5,3-dithiazocan-3-yl)phenol (CID 146020778) is 4-(1,5,3-dithiazocan-3-yl)phenol.
What is the SMILES notation for 4-(1,5,3-dithiazocan-3-yl)phenol?
The canonical SMILES for 4-(1,5,3-dithiazocan-3-yl)phenol is Oc1ccc(N2CSCCCSC2)cc1.
What is the InChIKey of 4-(1,5,3-dithiazocan-3-yl)phenol?
The InChIKey is LZDCKUIUIIYURR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NOS2/c13-11-4-2-10(3-5-11)12-8-14-6-1-7-15-9-12/h2-5,13H,1,6-9H2.
What are the key properties of 4-(1,5,3-dithiazocan-3-yl)phenol?
4-(1,5,3-dithiazocan-3-yl)phenol has a molecular weight of 241.38 g/mol, XLogP of 2.98, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,5,3-dithiazocan-3-yl)phenol is sourced from PubChem (CID 146020778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).