C11H15NOS2 — CID 146020778
4-(1,5,3-dithiazocan-3-yl)phenol (PubChem CID 146020778) has the molecular formula C11H15NOS2 and a molecular weight of 241.38 g/mol. Its IUPAC name is 4-(1,5,3-dithiazocan-3-yl)phenol.
| Compound Name | 4-(1,5,3-dithiazocan-3-yl)phenol |
|---|---|
| PubChem CID | 146020778 |
| Molecular Formula | C11H15NOS2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 4-(1,5,3-dithiazocan-3-yl)phenol |
| SMILES | Oc1ccc(N2CSCCCSC2)cc1 |
| InChI | InChI=1S/C11H15NOS2/c13-11-4-2-10(3-5-11)12-8-14-6-1-7-15-9-12/h2-5,13H,1,6-9H2 |
| InChIKey | LZDCKUIUIIYURR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |