C12H7Br2Cl2NO3S — CID 107659863
3-bromo-4-(4-bromo-2,5-dichlorophenoxy)benzenesulfonamide (PubChem CID 107659863) has the molecular formula C12H7Br2Cl2NO3S and a molecular weight of 475.97 g/mol. Its IUPAC name is 3-bromo-4-(4-bromo-2,5-dichlorophenoxy)benzenesulfonamide.
| Compound Name | 3-bromo-4-(4-bromo-2,5-dichlorophenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 107659863 |
| Molecular Formula | C12H7Br2Cl2NO3S |
| Molecular Weight | 475.97 g/mol |
| Exact Mass | 472.79 |
| IUPAC Name | 3-bromo-4-(4-bromo-2,5-dichlorophenoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Oc2cc(Cl)c(Br)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C12H7Br2Cl2NO3S/c13-7-4-10(16)12(5-9(7)15)20-11-2-1-6(3-8(11)14)21(17,18)19/h1-5H,(H2,17,18,19) |
| InChIKey | XLIZLDCQHBXWKN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.97 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|