C12H6BrCl3O3S — CID 112749266
3-(4-bromo-2,5-dichlorophenoxy)benzenesulfonyl chloride (PubChem CID 112749266) has the molecular formula C12H6BrCl3O3S and a molecular weight of 416.51 g/mol. Its IUPAC name is 3-(4-bromo-2,5-dichlorophenoxy)benzenesulfonyl chloride.
| Compound Name | 3-(4-bromo-2,5-dichlorophenoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 112749266 |
| Molecular Formula | C12H6BrCl3O3S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 413.83 |
| IUPAC Name | 3-(4-bromo-2,5-dichlorophenoxy)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cccc(Oc2cc(Cl)c(Br)cc2Cl)c1 |
| InChI | InChI=1S/C12H6BrCl3O3S/c13-9-5-11(15)12(6-10(9)14)19-7-2-1-3-8(4-7)20(16,17)18/h1-6H |
| InChIKey | QLILVDMNFGLVGI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|