C14H8BrCl3O2 — CID 107658611
1-[4-(4-bromo-2,5-dichlorophenoxy)-2-chlorophenyl]ethanone (PubChem CID 107658611) has the molecular formula C14H8BrCl3O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 1-[4-(4-bromo-2,5-dichlorophenoxy)-2-chlorophenyl]ethanone.
| Compound Name | 1-[4-(4-bromo-2,5-dichlorophenoxy)-2-chlorophenyl]ethanone |
|---|---|
| PubChem CID | 107658611 |
| Molecular Formula | C14H8BrCl3O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 391.88 |
| IUPAC Name | 1-[4-(4-bromo-2,5-dichlorophenoxy)-2-chlorophenyl]ethanone |
| SMILES | CC(=O)c1ccc(Oc2cc(Cl)c(Br)cc2Cl)cc1Cl |
| InChI | InChI=1S/C14H8BrCl3O2/c1-7(19)9-3-2-8(4-11(9)16)20-14-6-12(17)10(15)5-13(14)18/h2-6H,1H3 |
| InChIKey | BZGKXTPKKBMGHN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|