C14H11BrCl2N2O2 — CID 107658362
4-(4-bromo-2,5-dichlorophenoxy)-N'-hydroxy-2-methylbenzenecarboximidamide (PubChem CID 107658362) has the molecular formula C14H11BrCl2N2O2 and a molecular weight of 390.06 g/mol. Its IUPAC name is 4-(4-bromo-2,5-dichlorophenoxy)-N'-hydroxy-2-methylbenzenecarboximidamide.
| Compound Name | 4-(4-bromo-2,5-dichlorophenoxy)-N'-hydroxy-2-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 107658362 |
| Molecular Formula | C14H11BrCl2N2O2 |
| Molecular Weight | 390.06 g/mol |
| Exact Mass | 387.94 |
| IUPAC Name | 4-(4-bromo-2,5-dichlorophenoxy)-N'-hydroxy-2-methylbenzenecarboximidamide |
| SMILES | Cc1cc(Oc2cc(Cl)c(Br)cc2Cl)ccc1/C(N)=N/O |
| InChI | InChI=1S/C14H11BrCl2N2O2/c1-7-4-8(2-3-9(7)14(18)19-20)21-13-6-11(16)10(15)5-12(13)17/h2-6,20H,1H3,(H2,18,19) |
| InChIKey | FNJYOTLJCIRLTI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.06 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|