C13H5Br2Cl2NO — CID 107658012
3-bromo-4-(4-bromo-2,5-dichlorophenoxy)benzonitrile (PubChem CID 107658012) has the molecular formula C13H5Br2Cl2NO and a molecular weight of 421.90 g/mol. Its IUPAC name is 3-bromo-4-(4-bromo-2,5-dichlorophenoxy)benzonitrile.
| Compound Name | 3-bromo-4-(4-bromo-2,5-dichlorophenoxy)benzonitrile |
|---|---|
| PubChem CID | 107658012 |
| Molecular Formula | C13H5Br2Cl2NO |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 418.81 |
| IUPAC Name | 3-bromo-4-(4-bromo-2,5-dichlorophenoxy)benzonitrile |
| SMILES | N#Cc1ccc(Oc2cc(Cl)c(Br)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C13H5Br2Cl2NO/c14-8-4-11(17)13(5-10(8)16)19-12-2-1-7(6-18)3-9(12)15/h1-5H |
| InChIKey | FOQGLFVDUDBMRI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|