C13H7BrCl2N2O — CID 107655342
2-amino-3-(4-bromo-2,5-dichlorophenoxy)benzonitrile (PubChem CID 107655342) has the molecular formula C13H7BrCl2N2O and a molecular weight of 358.02 g/mol. Its IUPAC name is 2-amino-3-(4-bromo-2,5-dichlorophenoxy)benzonitrile.
| Compound Name | 2-amino-3-(4-bromo-2,5-dichlorophenoxy)benzonitrile |
|---|---|
| PubChem CID | 107655342 |
| Molecular Formula | C13H7BrCl2N2O |
| Molecular Weight | 358.02 g/mol |
| Exact Mass | 355.91 |
| IUPAC Name | 2-amino-3-(4-bromo-2,5-dichlorophenoxy)benzonitrile |
| SMILES | N#Cc1cccc(Oc2cc(Cl)c(Br)cc2Cl)c1N |
| InChI | InChI=1S/C13H7BrCl2N2O/c14-8-4-10(16)12(5-9(8)15)19-11-3-1-2-7(6-17)13(11)18/h1-5H,18H2 |
| InChIKey | WGXIETVDHLGGLK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.02 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|