C12H8Cl3NNaO4S — CID 126960062
sodium 2-amino-6-chloro-3-(2,4-dichlorophenoxy)benzenesulfonate (PubChem CID 126960062) has the molecular formula C12H8Cl3NNaO4S and a molecular weight of 391.62 g/mol.
| Compound Name | sodium 2-amino-6-chloro-3-(2,4-dichlorophenoxy)benzenesulfonate |
|---|---|
| PubChem CID | 126960062 |
| Molecular Formula | C12H8Cl3NNaO4S |
| Molecular Weight | 391.62 g/mol |
| Exact Mass | 389.91 |
| IUPAC Name | — |
| SMILES | Nc1c(Oc2ccc(Cl)cc2Cl)ccc(Cl)c1S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C12H8Cl3NO4S.Na/c13-6-1-3-9(8(15)5-6)20-10-4-2-7(14)12(11(10)16)21(17,18)19;/h1-5H,16H2,(H,17,18,19); |
| InChIKey | WGADPDSDUNDJJP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|