C19H21FN2O4S — CID 26531285
N-[5-[cyclopropyl-[(4-fluorophenyl)methyl]sulfamoyl]-2-methoxyphenyl]acetamide (PubChem CID 26531285) has the molecular formula C19H21FN2O4S and a molecular weight of 392.45 g/mol. Its IUPAC name is N-[5-[cyclopropyl-[(4-fluorophenyl)methyl]sulfamoyl]-2-methoxyphenyl]acetamide.
| Compound Name | N-[5-[cyclopropyl-[(4-fluorophenyl)methyl]sulfamoyl]-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 26531285 |
| Molecular Formula | C19H21FN2O4S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[5-[cyclopropyl-[(4-fluorophenyl)methyl]sulfamoyl]-2-methoxyphenyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccc(F)cc2)C2CC2)cc1NC(C)=O |
| InChI | InChI=1S/C19H21FN2O4S/c1-13(23)21-18-11-17(9-10-19(18)26-2)27(24,25)22(16-7-8-16)12-14-3-5-15(20)6-4-14/h3-6,9-11,16H,7-8,12H2,1-2H3,(H,21,23) |
| InChIKey | AIPDHYLYGGJZRJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |