C16H24N2O6S2 — CID 8797616
N-[5-[[(3R)-1,1-dioxothiolan-3-yl]-propylsulfamoyl]-2-methoxyphenyl]acetamide (PubChem CID 8797616) has the molecular formula C16H24N2O6S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[5-[[(3R)-1,1-dioxothiolan-3-yl]-propylsulfamoyl]-2-methoxyphenyl]acetamide.
| Compound Name | N-[5-[[(3R)-1,1-dioxothiolan-3-yl]-propylsulfamoyl]-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 8797616 |
| Molecular Formula | C16H24N2O6S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-[5-[[(3R)-1,1-dioxothiolan-3-yl]-propylsulfamoyl]-2-methoxyphenyl]acetamide |
| SMILES | CCCN([C@@H]1CCS(=O)(=O)C1)S(=O)(=O)c1ccc(OC)c(NC(C)=O)c1 |
| InChI | InChI=1S/C16H24N2O6S2/c1-4-8-18(13-7-9-25(20,21)11-13)26(22,23)14-5-6-16(24-3)15(10-14)17-12(2)19/h5-6,10,13H,4,7-9,11H2,1-3H3,(H,17,19)/t13-/m1/s1 |
| InChIKey | BWGJRQKKBBSRCB-CYBMUJFWSA-N |
| XLogP | 1.24 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |