C17H27NO6S2 — CID 55639384
N-(1,1-dioxothiolan-3-yl)-4-(2-methoxyethoxy)-3-methyl-N-propylbenzenesulfonamide (PubChem CID 55639384) has the molecular formula C17H27NO6S2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-(2-methoxyethoxy)-3-methyl-N-propylbenzenesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-(2-methoxyethoxy)-3-methyl-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 55639384 |
| Molecular Formula | C17H27NO6S2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-(2-methoxyethoxy)-3-methyl-N-propylbenzenesulfonamide |
| SMILES | CCCN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ccc(OCCOC)c(C)c1 |
| InChI | InChI=1S/C17H27NO6S2/c1-4-8-18(15-7-11-25(19,20)13-15)26(21,22)16-5-6-17(14(2)12-16)24-10-9-23-3/h5-6,12,15H,4,7-11,13H2,1-3H3 |
| InChIKey | BDXCZZJUIOUFJP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|